C24H32O6 — CID 3355803
11,24-diethyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene (PubChem CID 3355803) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 11,24-diethyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene.
| Compound Name | 11,24-diethyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene |
|---|---|
| PubChem CID | 3355803 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 11,24-diethyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene |
| SMILES | CCc1ccc2c(c1)OCCOCCOc1ccc(CC)cc1OCCOCCO2 |
| InChI | InChI=1S/C24H32O6/c1-3-19-5-7-21-23(17-19)29-15-11-25-10-14-28-22-8-6-20(4-2)18-24(22)30-16-12-26-9-13-27-21/h5-8,17-18H,3-4,9-16H2,1-2H3 |
| InChIKey | QIHARHPAWQXEFL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |