C32H46O12 — CID 101436486
20-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene (PubChem CID 101436486) has the molecular formula C32H46O12 and a molecular weight of 622.71 g/mol. Its IUPAC name is 20-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene.
| Compound Name | 20-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene |
|---|---|
| PubChem CID | 101436486 |
| Molecular Formula | C32H46O12 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 20-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene |
| SMILES | c1cc2c(cc1-c1ccc3c(c1)OCCOCCOCCOCCOCCO3)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C32H46O12/c1-3-29-31(43-23-19-39-15-11-35-7-5-33-9-13-37-17-21-41-29)25-27(1)28-2-4-30-32(26-28)44-24-20-40-16-12-36-8-6-34-10-14-38-18-22-42-30/h1-4,25-26H,5-24H2 |
| InChIKey | WRMWUSDFFSTEDA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |