C20H21Br3O6 — CID 6420336
11,12,24-tribromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene (PubChem CID 6420336) has the molecular formula C20H21Br3O6 and a molecular weight of 597.09 g/mol. Its IUPAC name is 11,12,24-tribromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene.
| Compound Name | 11,12,24-tribromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene |
|---|---|
| PubChem CID | 6420336 |
| Molecular Formula | C20H21Br3O6 |
| Molecular Weight | 597.09 g/mol |
| Exact Mass | 593.89 |
| IUPAC Name | 11,12,24-tribromo-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene |
| SMILES | Brc1ccc2c(c1)OCCOCCOc1cc(Br)c(Br)cc1OCCOCCO2 |
| InChI | InChI=1S/C20H21Br3O6/c21-14-1-2-17-18(11-14)27-8-4-25-6-10-29-20-13-16(23)15(22)12-19(20)28-9-5-24-3-7-26-17/h1-2,11-13H,3-10H2 |
| InChIKey | DYNZERRZPSTDPM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.09 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |