C26H36O8 — CID 90365748
14,30-dimethyl-2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(28),12(17),13,15,29,31-hexaene (PubChem CID 90365748) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is 14,30-dimethyl-2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(28),12(17),13,15,29,31-hexaene.
| Compound Name | 14,30-dimethyl-2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(28),12(17),13,15,29,31-hexaene |
|---|---|
| PubChem CID | 90365748 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 14,30-dimethyl-2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(28),12(17),13,15,29,31-hexaene |
| SMILES | Cc1ccc2c(c1)OCCOCCOCCOc1ccc(C)cc1OCCOCCOCCO2 |
| InChI | InChI=1S/C26H36O8/c1-21-3-5-23-25(19-21)33-17-13-29-9-7-28-12-16-32-24-6-4-22(2)20-26(24)34-18-14-30-10-8-27-11-15-31-23/h3-6,19-20H,7-18H2,1-2H3 |
| InChIKey | PFTHQCWJBWQTHJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |