C15H14O4 — CID 19894451
1,3-benzodioxole;5-methyl-1,3-benzodioxole (PubChem CID 19894451) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1,3-benzodioxole;5-methyl-1,3-benzodioxole.
| Compound Name | 1,3-benzodioxole;5-methyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 19894451 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,3-benzodioxole;5-methyl-1,3-benzodioxole |
| SMILES | Cc1ccc2c(c1)OCO2.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H8O2.C7H6O2/c1-6-2-3-7-8(4-6)10-5-9-7;1-2-4-7-6(3-1)8-5-9-7/h2-4H,5H2,1H3;1-4H,5H2 |
| InChIKey | MYVKREGRVNONCC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |