About 1,3-benzodioxole;hydrobromide
1,3-benzodioxole;hydrobromide (PubChem CID 172797493) has the molecular formula C7H7BrO2
and a molecular weight of 203.03 g/mol. Its IUPAC name is 1,3-benzodioxole;hydrobromide.
Molecular Properties
| Compound Name | 1,3-benzodioxole;hydrobromide |
| PubChem CID | 172797493 |
| Molecular Formula | C7H7BrO2 |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | 1,3-benzodioxole;hydrobromide |
| SMILES | Br.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O2.BrH/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,5H2;1H |
| InChIKey | QKFMNDQWADJFMB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-benzodioxole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzodioxole;hydrobromide?
The IUPAC name of 1,3-benzodioxole;hydrobromide (CID 172797493) is 1,3-benzodioxole;hydrobromide.
What is the SMILES notation for 1,3-benzodioxole;hydrobromide?
The canonical SMILES for 1,3-benzodioxole;hydrobromide is Br.c1ccc2c(c1)OCO2.
What is the InChIKey of 1,3-benzodioxole;hydrobromide?
The InChIKey is QKFMNDQWADJFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.BrH/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,5H2;1H.
What are the key properties of 1,3-benzodioxole;hydrobromide?
1,3-benzodioxole;hydrobromide has a molecular weight of 203.03 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxole;hydrobromide is sourced from PubChem (CID 172797493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).