C7H7BrO2 — CID 172797493
1,3-benzodioxole;hydrobromide (PubChem CID 172797493) has the molecular formula C7H7BrO2 and a molecular weight of 203.03 g/mol. Its IUPAC name is 1,3-benzodioxole;hydrobromide.
| Compound Name | 1,3-benzodioxole;hydrobromide |
|---|---|
| PubChem CID | 172797493 |
| Molecular Formula | C7H7BrO2 |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | 1,3-benzodioxole;hydrobromide |
| SMILES | Br.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O2.BrH/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,5H2;1H |
| InChIKey | QKFMNDQWADJFMB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |