C11H16O2 — CID 143197375
1,3-benzodioxole;ethane;ethene (PubChem CID 143197375) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,3-benzodioxole;ethane;ethene.
| Compound Name | 1,3-benzodioxole;ethane;ethene |
|---|---|
| PubChem CID | 143197375 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,3-benzodioxole;ethane;ethene |
| SMILES | C=C.CC.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O2.C2H6.C2H4/c1-2-4-7-6(3-1)8-5-9-7;2*1-2/h1-4H,5H2;1-2H3;1-2H2 |
| InChIKey | DJRGMXKCZZIROZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|