About 1,3-benzodioxole;ethane;ethene
1,3-benzodioxole;ethane;ethene (PubChem CID 143197375) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,3-benzodioxole;ethane;ethene.
Molecular Properties
| Compound Name | 1,3-benzodioxole;ethane;ethene |
| PubChem CID | 143197375 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,3-benzodioxole;ethane;ethene |
| SMILES | C=C.CC.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O2.C2H6.C2H4/c1-2-4-7-6(3-1)8-5-9-7;2*1-2/h1-4H,5H2;1-2H3;1-2H2 |
| InChIKey | DJRGMXKCZZIROZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzodioxole;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzodioxole;ethane;ethene?
The IUPAC name of 1,3-benzodioxole;ethane;ethene (CID 143197375) is 1,3-benzodioxole;ethane;ethene.
What is the SMILES notation for 1,3-benzodioxole;ethane;ethene?
The canonical SMILES for 1,3-benzodioxole;ethane;ethene is C=C.CC.c1ccc2c(c1)OCO2.
What is the InChIKey of 1,3-benzodioxole;ethane;ethene?
The InChIKey is DJRGMXKCZZIROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H6.C2H4/c1-2-4-7-6(3-1)8-5-9-7;2*1-2/h1-4H,5H2;1-2H3;1-2H2.
What are the key properties of 1,3-benzodioxole;ethane;ethene?
1,3-benzodioxole;ethane;ethene has a molecular weight of 180.25 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxole;ethane;ethene is sourced from PubChem (CID 143197375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).