C19H28O2 — CID 159794832
benzene;3,4-dihydro-2H-1,5-benzodioxepine;ethane (PubChem CID 159794832) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is benzene;3,4-dihydro-2H-1,5-benzodioxepine;ethane.
| Compound Name | benzene;3,4-dihydro-2H-1,5-benzodioxepine;ethane |
|---|---|
| PubChem CID | 159794832 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | benzene;3,4-dihydro-2H-1,5-benzodioxepine;ethane |
| SMILES | CC.CC.c1ccc2c(c1)OCCCO2.c1ccccc1 |
| InChI | InChI=1S/C9H10O2.C6H6.2C2H6/c1-2-5-9-8(4-1)10-6-3-7-11-9;1-2-4-6-5-3-1;2*1-2/h1-2,4-5H,3,6-7H2;1-6H;2*1-2H3 |
| InChIKey | NJAMQJIOEMWPHR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |