C10H12O3 — CID 585925
2,3,5,6-tetrahydro-1,4,7-benzotrioxonine (PubChem CID 585925) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine.
| Compound Name | 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine |
|---|---|
| PubChem CID | 585925 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine |
| SMILES | c1ccc2c(c1)OCCOCCO2 |
| InChI | InChI=1S/C10H12O3/c1-2-4-10-9(3-1)12-7-5-11-6-8-13-10/h1-4H,5-8H2 |
| InChIKey | HOWRGZDIVIHRJM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |