C17H26O6 — CID 22411101
2,5,8,11,14,18-hexaoxabicyclo[17.4.0]tricosa-1(23),19,21-triene (PubChem CID 22411101) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2,5,8,11,14,18-hexaoxabicyclo[17.4.0]tricosa-1(23),19,21-triene.
| Compound Name | 2,5,8,11,14,18-hexaoxabicyclo[17.4.0]tricosa-1(23),19,21-triene |
|---|---|
| PubChem CID | 22411101 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2,5,8,11,14,18-hexaoxabicyclo[17.4.0]tricosa-1(23),19,21-triene |
| SMILES | c1ccc2c(c1)OCCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C17H26O6/c1-2-5-17-16(4-1)22-7-3-6-18-8-9-19-10-11-20-12-13-21-14-15-23-17/h1-2,4-5H,3,6-15H2 |
| InChIKey | UVPKHIZQBMMQTI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |