C12H16O2 — CID 13197605
2,3,4,5,6,7-hexahydro-1,8-benzodioxecine (PubChem CID 13197605) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydro-1,8-benzodioxecine.
| Compound Name | 2,3,4,5,6,7-hexahydro-1,8-benzodioxecine |
|---|---|
| PubChem CID | 13197605 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2,3,4,5,6,7-hexahydro-1,8-benzodioxecine |
| SMILES | c1ccc2c(c1)OCCCCCCO2 |
| InChI | InChI=1S/C12H16O2/c1-2-6-10-14-12-8-4-3-7-11(12)13-9-5-1/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChIKey | RJTDPQPBXNYWNG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |