C22H24O6 — CID 102529624
2,7,16,21-tetraoxatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene-8,15-dione (PubChem CID 102529624) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2,7,16,21-tetraoxatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene-8,15-dione.
| Compound Name | 2,7,16,21-tetraoxatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene-8,15-dione |
|---|---|
| PubChem CID | 102529624 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2,7,16,21-tetraoxatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene-8,15-dione |
| SMILES | O=C1OCCCCOc2ccccc2OCCCCOC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24O6/c23-21-17-9-1-2-10-18(17)22(24)28-16-8-6-14-26-20-12-4-3-11-19(20)25-13-5-7-15-27-21/h1-4,9-12H,5-8,13-16H2 |
| InChIKey | VNXSLLIMYRRRRZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |