About 2-benzofuran-1,3-dione;oxolane
2-benzofuran-1,3-dione;oxolane (PubChem CID 158210256) has the molecular formula C12H12O4
and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;oxolane.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;oxolane |
| PubChem CID | 158210256 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-benzofuran-1,3-dione;oxolane |
| SMILES | C1CCOC1.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C4H8O/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-4-5-3-1/h1-4H;1-4H2 |
| InChIKey | GBZJFAYRSMFIJA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;oxolane?
The IUPAC name of 2-benzofuran-1,3-dione;oxolane (CID 158210256) is 2-benzofuran-1,3-dione;oxolane.
What is the SMILES notation for 2-benzofuran-1,3-dione;oxolane?
The canonical SMILES for 2-benzofuran-1,3-dione;oxolane is C1CCOC1.O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione;oxolane?
The InChIKey is GBZJFAYRSMFIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.C4H8O/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-4-5-3-1/h1-4H;1-4H2.
What are the key properties of 2-benzofuran-1,3-dione;oxolane?
2-benzofuran-1,3-dione;oxolane has a molecular weight of 220.22 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;oxolane is sourced from PubChem (CID 158210256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).