C14H18O2 — CID 72551303
2-oxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-10-one (PubChem CID 72551303) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-oxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-10-one.
| Compound Name | 2-oxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-10-one |
|---|---|
| PubChem CID | 72551303 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-oxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-10-one |
| SMILES | O=C1CCCCCCCOc2ccccc21 |
| InChI | InChI=1S/C14H18O2/c15-13-9-4-2-1-3-7-11-16-14-10-6-5-8-12(13)14/h5-6,8,10H,1-4,7,9,11H2 |
| InChIKey | PWNIPQHINFUFEI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |