C14H18O2 — CID 15754865
8-tert-butyl-3,4-dihydro-2H-1-benzoxepin-5-one (PubChem CID 15754865) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 8-tert-butyl-3,4-dihydro-2H-1-benzoxepin-5-one.
| Compound Name | 8-tert-butyl-3,4-dihydro-2H-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 15754865 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 8-tert-butyl-3,4-dihydro-2H-1-benzoxepin-5-one |
| SMILES | CC(C)(C)c1ccc2c(c1)OCCCC2=O |
| InChI | InChI=1S/C14H18O2/c1-14(2,3)10-6-7-11-12(15)5-4-8-16-13(11)9-10/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | SUAWJBUGFRGHNA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |