C16H25NO5S — CID 71405189
ethanethioamide;2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene (PubChem CID 71405189) has the molecular formula C16H25NO5S and a molecular weight of 343.44 g/mol. Its IUPAC name is ethanethioamide;2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene.
| Compound Name | ethanethioamide;2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene |
|---|---|
| PubChem CID | 71405189 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | ethanethioamide;2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene |
| SMILES | CC(N)=S.c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H20O5.C2H5NS/c1-2-4-14-13(3-1)18-11-9-16-7-5-15-6-8-17-10-12-19-14;1-2(3)4/h1-4H,5-12H2;1H3,(H2,3,4) |
| InChIKey | HAFLVUHUXBDWQH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|