C9H11NO4 — CID 67613608
carbamic acid;2,3-dihydro-1,4-benzodioxine (PubChem CID 67613608) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is carbamic acid;2,3-dihydro-1,4-benzodioxine.
| Compound Name | carbamic acid;2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 67613608 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | carbamic acid;2,3-dihydro-1,4-benzodioxine |
| SMILES | NC(=O)O.c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H8O2.CH3NO2/c1-2-4-8-7(3-1)9-5-6-10-8;2-1(3)4/h1-4H,5-6H2;2H2,(H,3,4) |
| InChIKey | BJUPKWZTXRXARN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |