C9H9NO3 — CID 659279
2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 659279) has the molecular formula C9H9NO3 and a molecular weight of 179.18 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | 2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 659279 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H9NO3/c10-9(11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5H,3-4H2,(H2,10,11) |
| InChIKey | HZHZDULNPYDZAQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |