C22H26N2O6S2 — CID 4029467
2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarbothioamide (PubChem CID 4029467) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarbothioamide.
| Compound Name | 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarbothioamide |
|---|---|
| PubChem CID | 4029467 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarbothioamide |
| SMILES | NC(=S)c1ccc2c(c1)OCCOCCOc1ccc(C(N)=S)cc1OCCOCCO2 |
| InChI | InChI=1S/C22H26N2O6S2/c23-21(31)15-1-3-17-19(13-15)29-11-7-26-6-10-28-18-4-2-16(22(24)32)14-20(18)30-12-8-25-5-9-27-17/h1-4,13-14H,5-12H2,(H2,23,31)(H2,24,32) |
| InChIKey | UAALDPGBMIKLCM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|