C32H44N2O10 — CID 4542130
1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-N-[1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethylideneamino]ethanimine (PubChem CID 4542130) has the molecular formula C32H44N2O10 and a molecular weight of 616.71 g/mol. Its IUPAC name is 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-N-[1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethylideneamino]ethanimine.
| Compound Name | 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-N-[1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethylideneamino]ethanimine |
|---|---|
| PubChem CID | 4542130 |
| Molecular Formula | C32H44N2O10 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-N-[1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethylideneamino]ethanimine |
| SMILES | CC(=NN=C(C)c1ccc2c(c1)OCCOCCOCCOCCO2)c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C32H44N2O10/c1-25(27-3-5-29-31(23-27)43-21-17-39-13-9-35-7-11-37-15-19-41-29)33-34-26(2)28-4-6-30-32(24-28)44-22-18-40-14-10-36-8-12-38-16-20-42-30/h3-6,23-24H,7-22H2,1-2H3 |
| InChIKey | GIZVZBMRSXNGMH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|