About ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate
ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate (PubChem CID 138479505) has the molecular formula C13H16O5
and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate.
Analyze ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate?
The IUPAC name of ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate (CID 138479505) is ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate.
What is the SMILES notation for ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate?
The canonical SMILES for ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate is CCOC(=O)c1ccc2c(c1)OCCOCCO2.
What is the InChIKey of ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate?
The InChIKey is OIKZGGXWWNVOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-2-16-13(14)10-3-4-11-12(9-10)18-8-6-15-5-7-17-11/h3-4,9H,2,5-8H2,1H3.
What are the key properties of ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate?
ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate has a molecular weight of 252.27 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-9-carboxylate is sourced from PubChem (CID 138479505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).