C18H16O6 — CID 3926657
(4-ethoxycarbonylphenyl)methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 3926657) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl)methyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl)methyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 3926657 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (4-ethoxycarbonylphenyl)methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc(COC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H16O6/c1-2-21-17(19)13-5-3-12(4-6-13)10-22-18(20)14-7-8-15-16(9-14)24-11-23-15/h3-9H,2,10-11H2,1H3 |
| InChIKey | OJFNLUNUASMLEQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |