C17H17NO4 — CID 6459912
1,3-benzodioxol-5-ylmethyl 4-(dimethylamino)benzoate (PubChem CID 6459912) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 4-(dimethylamino)benzoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 6459912 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-18(2)14-6-4-13(5-7-14)17(19)20-10-12-3-8-15-16(9-12)22-11-21-15/h3-9H,10-11H2,1-2H3 |
| InChIKey | OKNZDOCGFGZFJL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |