C23H19NO8 — CID 10216752
bis(1,3-benzodioxol-5-ylmethyl) 1-methylpyrrole-2,4-dicarboxylate (PubChem CID 10216752) has the molecular formula C23H19NO8 and a molecular weight of 437.40 g/mol. Its IUPAC name is bis(1,3-benzodioxol-5-ylmethyl) 1-methylpyrrole-2,4-dicarboxylate.
| Compound Name | bis(1,3-benzodioxol-5-ylmethyl) 1-methylpyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10216752 |
| Molecular Formula | C23H19NO8 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | bis(1,3-benzodioxol-5-ylmethyl) 1-methylpyrrole-2,4-dicarboxylate |
| SMILES | Cn1cc(C(=O)OCc2ccc3c(c2)OCO3)cc1C(=O)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19NO8/c1-24-9-16(22(25)27-10-14-2-4-18-20(6-14)31-12-29-18)8-17(24)23(26)28-11-15-3-5-19-21(7-15)32-13-30-19/h2-9H,10-13H2,1H3 |
| InChIKey | KJKANHOYWRBKJH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |