C22H16N2O8 — CID 10113884
bis(1,3-benzodioxol-5-ylmethyl) pyrimidine-4,6-dicarboxylate (PubChem CID 10113884) has the molecular formula C22H16N2O8 and a molecular weight of 436.38 g/mol. Its IUPAC name is bis(1,3-benzodioxol-5-ylmethyl) pyrimidine-4,6-dicarboxylate.
| Compound Name | bis(1,3-benzodioxol-5-ylmethyl) pyrimidine-4,6-dicarboxylate |
|---|---|
| PubChem CID | 10113884 |
| Molecular Formula | C22H16N2O8 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | bis(1,3-benzodioxol-5-ylmethyl) pyrimidine-4,6-dicarboxylate |
| SMILES | O=C(OCc1ccc2c(c1)OCO2)c1cc(C(=O)OCc2ccc3c(c2)OCO3)ncn1 |
| InChI | InChI=1S/C22H16N2O8/c25-21(27-8-13-1-3-17-19(5-13)31-11-29-17)15-7-16(24-10-23-15)22(26)28-9-14-2-4-18-20(6-14)32-12-30-18/h1-7,10H,8-9,11-12H2 |
| InChIKey | WSCXXRULRVJTPG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |