C15H18O4 — CID 55313867
1,3-benzodioxol-5-ylmethyl 2-cyclopentylacetate (PubChem CID 55313867) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 2-cyclopentylacetate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 2-cyclopentylacetate |
|---|---|
| PubChem CID | 55313867 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 2-cyclopentylacetate |
| SMILES | O=C(CC1CCCC1)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18O4/c16-15(8-11-3-1-2-4-11)17-9-12-5-6-13-14(7-12)19-10-18-13/h5-7,11H,1-4,8-10H2 |
| InChIKey | KZVVZUNNIXREAY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |