C13H14O4 — CID 63906029
2-(1,3-benzodioxol-5-ylmethoxy)-1-cyclopropylethanone (PubChem CID 63906029) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethoxy)-1-cyclopropylethanone.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethoxy)-1-cyclopropylethanone |
|---|---|
| PubChem CID | 63906029 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethoxy)-1-cyclopropylethanone |
| SMILES | O=C(COCc1ccc2c(c1)OCO2)C1CC1 |
| InChI | InChI=1S/C13H14O4/c14-11(10-2-3-10)7-15-6-9-1-4-12-13(5-9)17-8-16-12/h1,4-5,10H,2-3,6-8H2 |
| InChIKey | WNAORIBUBCOXCF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |