C11H14O3 — CID 10262036
5-(propoxymethyl)-1,3-benzodioxole (PubChem CID 10262036) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-(propoxymethyl)-1,3-benzodioxole.
| Compound Name | 5-(propoxymethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 10262036 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-(propoxymethyl)-1,3-benzodioxole |
| SMILES | CCCOCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14O3/c1-2-5-12-7-9-3-4-10-11(6-9)14-8-13-10/h3-4,6H,2,5,7-8H2,1H3 |
| InChIKey | UOERABCMIUSRNK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|