C10H12O4 — CID 20689919
5-(methoxymethoxymethyl)-1,3-benzodioxole (PubChem CID 20689919) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 5-(methoxymethoxymethyl)-1,3-benzodioxole.
| Compound Name | 5-(methoxymethoxymethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 20689919 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 5-(methoxymethoxymethyl)-1,3-benzodioxole |
| SMILES | COCOCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12O4/c1-11-6-12-5-8-2-3-9-10(4-8)14-7-13-9/h2-4H,5-7H2,1H3 |
| InChIKey | MLVKUQIONFECGC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|