C9H7NO3 — CID 71424402
1,3-benzodioxol-5-ylmethyl cyanate (PubChem CID 71424402) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl cyanate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl cyanate |
|---|---|
| PubChem CID | 71424402 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl cyanate |
| SMILES | N#COCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H7NO3/c10-5-11-4-7-1-2-8-9(3-7)13-6-12-8/h1-3H,4,6H2 |
| InChIKey | ICRZUTUARYZVMU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|