C9H8F2O3 — CID 162716617
5-(difluoromethoxymethyl)-1,3-benzodioxole (PubChem CID 162716617) has the molecular formula C9H8F2O3 and a molecular weight of 202.16 g/mol. Its IUPAC name is 5-(difluoromethoxymethyl)-1,3-benzodioxole.
| Compound Name | 5-(difluoromethoxymethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 162716617 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-(difluoromethoxymethyl)-1,3-benzodioxole |
| SMILES | FC(F)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H8F2O3/c10-9(11)12-4-6-1-2-7-8(3-6)14-5-13-7/h1-3,9H,4-5H2 |
| InChIKey | GJPXIVRTAZRWPN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |