C8H7BF3O2- — CID 138967378
1,3-benzodioxol-5-ylmethyl(trifluoro)boranuide (PubChem CID 138967378) has the molecular formula C8H7BF3O2- and a molecular weight of 202.95 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl(trifluoro)boranuide.
| Compound Name | 1,3-benzodioxol-5-ylmethyl(trifluoro)boranuide |
|---|---|
| PubChem CID | 138967378 |
| Molecular Formula | C8H7BF3O2- |
| Molecular Weight | 202.95 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl(trifluoro)boranuide |
| SMILES | F[B-](F)(F)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H7BF3O2/c10-9(11,12)4-6-1-2-7-8(3-6)14-5-13-7/h1-3H,4-5H2/q-1 |
| InChIKey | JLWPKTMCSZTPGJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.95 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|