C10H13IO2 — CID 163882429
1,3-benzodioxol-5-ylmethyl(dimethyl)-λ3-iodane (PubChem CID 163882429) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl(dimethyl)-λ3-iodane.
| Compound Name | 1,3-benzodioxol-5-ylmethyl(dimethyl)-λ3-iodane |
|---|---|
| PubChem CID | 163882429 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl(dimethyl)-λ3-iodane |
| SMILES | CI(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13IO2/c1-11(2)6-8-3-4-9-10(5-8)13-7-12-9/h3-5H,6-7H2,1-2H3 |
| InChIKey | PUKFKZFWTPJGJT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|