C10H14N2O2 — CID 115225852
N'-(1,3-benzodioxol-5-ylmethyl)-N'-methylmethanediamine (PubChem CID 115225852) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethyl)-N'-methylmethanediamine.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethyl)-N'-methylmethanediamine |
|---|---|
| PubChem CID | 115225852 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethyl)-N'-methylmethanediamine |
| SMILES | CN(CN)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H14N2O2/c1-12(6-11)5-8-2-3-9-10(4-8)14-7-13-9/h2-4H,5-7,11H2,1H3 |
| InChIKey | YOWSMWXWMSKQKU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|