C8H9NO3 — CID 22419624
O-(1,3-benzodioxol-5-ylmethyl)hydroxylamine (PubChem CID 22419624) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is O-(1,3-benzodioxol-5-ylmethyl)hydroxylamine.
| Compound Name | O-(1,3-benzodioxol-5-ylmethyl)hydroxylamine |
|---|---|
| PubChem CID | 22419624 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | O-(1,3-benzodioxol-5-ylmethyl)hydroxylamine |
| SMILES | NOCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H9NO3/c9-12-4-6-1-2-7-8(3-6)11-5-10-7/h1-3H,4-5,9H2 |
| InChIKey | QVYDHNKTGNVGDS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|