C13H19NO3 — CID 54966297
5-(1,3-benzodioxol-5-ylmethoxy)pentan-1-amine (PubChem CID 54966297) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethoxy)pentan-1-amine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 54966297 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethoxy)pentan-1-amine |
| SMILES | NCCCCCOCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO3/c14-6-2-1-3-7-15-9-11-4-5-12-13(8-11)17-10-16-12/h4-5,8H,1-3,6-7,9-10,14H2 |
| InChIKey | IOAFTWABKCYLJD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|