C13H17BrO3 — CID 54195828
6-(4-bromobutoxymethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 54195828) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 6-(4-bromobutoxymethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(4-bromobutoxymethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 54195828 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 6-(4-bromobutoxymethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrCCCCOCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H17BrO3/c14-5-1-2-6-15-10-11-3-4-12-13(9-11)17-8-7-16-12/h3-4,9H,1-2,5-8,10H2 |
| InChIKey | PLSGWQVTDWXZMO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|