C12H15BrO2S — CID 115478209
6-(4-bromobutylsulfanyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 115478209) has the molecular formula C12H15BrO2S and a molecular weight of 303.22 g/mol. Its IUPAC name is 6-(4-bromobutylsulfanyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(4-bromobutylsulfanyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 115478209 |
| Molecular Formula | C12H15BrO2S |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 6-(4-bromobutylsulfanyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrCCCCSc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H15BrO2S/c13-5-1-2-8-16-10-3-4-11-12(9-10)15-7-6-14-11/h3-4,9H,1-2,5-8H2 |
| InChIKey | OKLFYISIJUDCIC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|