C18H25ClO6S — CID 100988044
4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylsulfanyl)butanoyl chloride (PubChem CID 100988044) has the molecular formula C18H25ClO6S and a molecular weight of 404.91 g/mol. Its IUPAC name is 4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylsulfanyl)butanoyl chloride.
| Compound Name | 4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylsulfanyl)butanoyl chloride |
|---|---|
| PubChem CID | 100988044 |
| Molecular Formula | C18H25ClO6S |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylsulfanyl)butanoyl chloride |
| SMILES | O=C(Cl)CCCSc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C18H25ClO6S/c19-18(20)2-1-13-26-15-3-4-16-17(14-15)25-12-10-23-8-6-21-5-7-22-9-11-24-16/h3-4,14H,1-2,5-13H2 |
| InChIKey | KSIFTHQCGXKZBC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|