C22H25ClN2O5S2 — CID 4851834
4-(4-chlorophenyl)sulfanyl-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]butan-1-one (PubChem CID 4851834) has the molecular formula C22H25ClN2O5S2 and a molecular weight of 497.04 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 4851834 |
| Molecular Formula | C22H25ClN2O5S2 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C22H25ClN2O5S2/c23-17-3-5-18(6-4-17)31-15-1-2-22(26)24-9-11-25(12-10-24)32(27,28)19-7-8-20-21(16-19)30-14-13-29-20/h3-8,16H,1-2,9-15H2 |
| InChIKey | WJNWYMWMRDLMIG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|