C15H18N2O7S — CID 2051972
3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-3-oxopropanoic acid (PubChem CID 2051972) has the molecular formula C15H18N2O7S and a molecular weight of 370.38 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 2051972 |
| Molecular Formula | C15H18N2O7S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C15H18N2O7S/c18-14(10-15(19)20)16-3-5-17(6-4-16)25(21,22)11-1-2-12-13(9-11)24-8-7-23-12/h1-2,9H,3-8,10H2,(H,19,20) |
| InChIKey | OSJZJTGKHQIKKA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|