C17H20N4O7S — CID 42930226
5-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 42930226) has the molecular formula C17H20N4O7S and a molecular weight of 424.44 g/mol. Its IUPAC name is 5-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42930226 |
| Molecular Formula | C17H20N4O7S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CC(=O)N2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)N1 |
| InChI | InChI=1S/C17H20N4O7S/c22-15(10-12-16(23)19-17(24)18-12)20-3-5-21(6-4-20)29(25,26)11-1-2-13-14(9-11)28-8-7-27-13/h1-2,9,12H,3-8,10H2,(H2,18,19,23,24) |
| InChIKey | PDRDANWRTRPFFD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|