C20H26N4O5S — CID 42910375
5-[3-oxo-3-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 42910375) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 5-[3-oxo-3-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-oxo-3-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42910375 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-[3-oxo-3-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2CCN(S(=O)(=O)c3ccc4c(c3)CCCC4)CC2)N1 |
| InChI | InChI=1S/C20H26N4O5S/c25-18(8-7-17-19(26)22-20(27)21-17)23-9-11-24(12-10-23)30(28,29)16-6-5-14-3-1-2-4-15(14)13-16/h5-6,13,17H,1-4,7-12H2,(H2,21,22,26,27) |
| InChIKey | BJVCMUOQCCVKPF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|