C17H19N5O5S — CID 26004165
2-[4-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 26004165) has the molecular formula C17H19N5O5S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-[4-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 26004165 |
| Molecular Formula | C17H19N5O5S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[4-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)CC[C@H]2NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C17H19N5O5S/c18-11-12-3-1-2-4-14(12)28(26,27)22-9-7-21(8-10-22)15(23)6-5-13-16(24)20-17(25)19-13/h1-4,13H,5-10H2,(H2,19,20,24,25)/t13-/m1/s1 |
| InChIKey | UAPKSBMHOHOREG-CYBMUJFWSA-N |
| XLogP | -0.62 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|