C15H19N3O3S — CID 110796557
2-[(4-propanoyl-1,4-diazepan-1-yl)sulfonyl]benzonitrile (PubChem CID 110796557) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[(4-propanoyl-1,4-diazepan-1-yl)sulfonyl]benzonitrile.
| Compound Name | 2-[(4-propanoyl-1,4-diazepan-1-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 110796557 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-[(4-propanoyl-1,4-diazepan-1-yl)sulfonyl]benzonitrile |
| SMILES | CCC(=O)N1CCCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-15(19)17-8-5-9-18(11-10-17)22(20,21)14-7-4-3-6-13(14)12-16/h3-4,6-7H,2,5,8-11H2,1H3 |
| InChIKey | KWZQVMNBZBKAHS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |