C16H22N4O2S2 — CID 8789075
N-butyl-4-(2-cyanophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 8789075) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-butyl-4-(2-cyanophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-butyl-4-(2-cyanophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8789075 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-butyl-4-(2-cyanophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | CCCCNC(=S)N1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C16H22N4O2S2/c1-2-3-8-18-16(23)19-9-11-20(12-10-19)24(21,22)15-7-5-4-6-14(15)13-17/h4-7H,2-3,8-12H2,1H3,(H,18,23) |
| InChIKey | MEEXMWJGWFPIRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|