C18H29N3O2S2 — CID 8768337
N-butyl-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 8768337) has the molecular formula C18H29N3O2S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is N-butyl-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-butyl-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8768337 |
| Molecular Formula | C18H29N3O2S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-butyl-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | CCCCNC(=S)N1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H29N3O2S2/c1-4-5-10-19-18(24)20-11-13-21(14-12-20)25(22,23)17-8-6-16(7-9-17)15(2)3/h6-9,15H,4-5,10-14H2,1-3H3,(H,19,24) |
| InChIKey | DASLVKODHMCXGF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|