C16H27N4O2S2+ — CID 8743471
dimethyl-[2-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]ethyl]azanium (PubChem CID 8743471) has the molecular formula C16H27N4O2S2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is dimethyl-[2-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8743471 |
| Molecular Formula | C16H27N4O2S2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | dimethyl-[2-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]ethyl]azanium |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=S)NCC[NH+](C)C)CC2)cc1 |
| InChI | InChI=1S/C16H26N4O2S2/c1-14-4-6-15(7-5-14)24(21,22)20-12-10-19(11-13-20)16(23)17-8-9-18(2)3/h4-7H,8-13H2,1-3H3,(H,17,23)/p+1 |
| InChIKey | NPWMNMRKYOLSCX-UHFFFAOYSA-O |
| XLogP | -0.68 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|