C19H27N3O2S2 — CID 17376319
N-(2-bicyclo[2.2.1]heptanyl)-4-(4-methylphenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 17376319) has the molecular formula C19H27N3O2S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-4-(4-methylphenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-4-(4-methylphenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17376319 |
| Molecular Formula | C19H27N3O2S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-4-(4-methylphenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=S)NC3CC4CCC3C4)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O2S2/c1-14-2-6-17(7-3-14)26(23,24)22-10-8-21(9-11-22)19(25)20-18-13-15-4-5-16(18)12-15/h2-3,6-7,15-16,18H,4-5,8-13H2,1H3,(H,20,25) |
| InChIKey | ITBGNBGLQWUHMG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|