C15H25N3O2S — CID 11919231
ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl]piperazine-1-carboxylate (PubChem CID 11919231) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11919231 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)N[C@@H]2C[C@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-2-20-15(19)18-7-5-17(6-8-18)14(21)16-13-10-11-3-4-12(13)9-11/h11-13H,2-10H2,1H3,(H,16,21)/t11-,12+,13+/m0/s1 |
| InChIKey | ODIYRIJZPRHYRT-YNEHKIRRSA-N |
| XLogP | 1.82 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|